4-methyl-2-propylpentanoic acid


4-methyl-2-propylpentanoic acid; propylisobutylacetic acid
Formula:C9H18O2; 158.24 g/mol
InChiKey:CYNQKJPFHUKKSF-UHFFFAOYSA-N
SMILES:CCCC(CC(C)C)C(O)=O
Molecular structure of 4-methyl-2-propylpentanoic acid

Isomers

butan-2-yl 3-methylbutanoate
Molecular structure of butan-2-yl 3-methylbutanoate
1-(2-butenyloxy)-2-propoxyethane
Molecular structure of 1-(2-butenyloxy)-2-propoxyethane
2-butoxyoxane
Molecular structure of 2-butoxyoxane
butyl 3-methylbutanoate
Molecular structure of butyl 3-methylbutanoate
butyl pentanoate
Molecular structure of butyl pentanoate
tert-butyl pivalate
Molecular structure of tert-butyl pivalate
1,1-diethoxy-3-methyl-2-butene
Molecular structure of 1,1-diethoxy-3-methyl-2-butene
6,6-dimethylheptanoic acid
Molecular structure of 6,6-dimethylheptanoic acid
ethyl heptanoate
Molecular structure of ethyl heptanoate
2-ethylheptanoic acid
Molecular structure of 2-ethylheptanoic acid
heptyl acetate
Molecular structure of heptyl acetate
hexyl propanoate
Molecular structure of hexyl propanoate
3-methylbutyl butanoate
Molecular structure of 3-methylbutyl butanoate
3-methylbutyl butyrate
Molecular structure of 3-methylbutyl butyrate
3-methylbutyl 2-methylpropanoate
Molecular structure of 3-methylbutyl 2-methylpropanoate
methyl 2-ethylhexanoate
Molecular structure of methyl 2-ethylhexanoate
methyl octanoate
Molecular structure of methyl octanoate
2-methyloctanoic acid
Molecular structure of 2-methyloctanoic acid
4-methyloctanoic acid
Molecular structure of 4-methyloctanoic acid
2-methyl-2-pentyl-1,3-dioxolane
Molecular structure of 2-methyl-2-pentyl-1,3-dioxolane
2-[(2-methylpropan-2-yl)oxy]oxane
Molecular structure of 2-[(2-methylpropan-2-yl)oxy]oxane
2-methylpropyl 3-methylbutanoate
Molecular structure of 2-methylpropyl 3-methylbutanoate
2-methylpropyl pentanoate
Molecular structure of 2-methylpropyl pentanoate
4-methyl-2-propylpentanoic acid
Molecular structure of 4-methyl-2-propylpentanoic acid
nonanoic acid
Molecular structure of nonanoic acid
octyl formate
Molecular structure of octyl formate
pentyl butanoate
Molecular structure of pentyl butanoate
pentyl 2-methylpropanoate
Molecular structure of pentyl 2-methylpropanoate
propyl hexanoate
Molecular structure of propyl hexanoate
2-propylhexanoic acid
Molecular structure of 2-propylhexanoic acid
3,5,5-trimethylhexanoic acid
Molecular structure of 3,5,5-trimethylhexanoic acid